CAS 743444-23-7 is the registry number for 2-Chloro-N-(9,10-dioxo-9,10-dihydroanthracen-2-yl)propanamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-chloro-N-(9,10-dioxoanthracen-2-yl)propanamide (CAS 743444-23-7) is a chemical compound with the molecular formula C17H12ClNO3 and a molecular weight of 313.7 g/mol. IUPAC name: 2-chloro-N-(9,10-dioxoanthracen-2-yl)propanamide. InChIKey: RDXXPDAIYCTAAT-UHFFFAOYSA-N.
| Molecular formula | C17H12ClNO3 |
|---|---|
| Molecular weight | 313.7 g/mol |
| IUPAC name | 2-chloro-N-(9,10-dioxoanthracen-2-yl)propanamide |
| InChIKey | RDXXPDAIYCTAAT-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=CC2=C(C=C1)C(=O)C3=CC=CC=C3C2=O)Cl |
Computed by PubChem (NCBI)