CAS 2242748-19-0 is the registry number for Rel-(2R,3S)-3-(trifluoromethyl)pyrrolidine-2-carboxylic acid hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3R)-3-(trifluoromethyl)pyrrolidine-2-carboxylic acid;hydrochloride (CAS 2242748-19-0) is a chemical compound with the molecular formula C6H9ClF3NO2 and a molecular weight of 219.59 g/mol. IUPAC name: (2S,3R)-3-(trifluoromethyl)pyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: VMHOUBODDGCOQF-HJXLNUONSA-N.
| Molecular formula | C6H9ClF3NO2 |
|---|---|
| Molecular weight | 219.59 g/mol |
| IUPAC name | (2S,3R)-3-(trifluoromethyl)pyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | VMHOUBODDGCOQF-HJXLNUONSA-N |
| SMILES | C1CN[C@@H]([C@@H]1C(F)(F)F)C(=O)O.Cl |
Computed by PubChem (NCBI)