Products 2306265-59-6
CAS 2306265-59-6 appears in our catalog under these names: 3-(Chloromethyl)azetidine trifluoroacetic acid, 95%, 3-(Chloromethyl)azetidine, trifluoroacetic acid, 97%, 3-(Chloromethyl)azetidine trifluoroacetic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg, 5g, 10g.
3-(chloromethyl)azetidine;2,2,2-trifluoroacetic acid (CAS 2306265-59-6) is a chemical compound with the molecular formula C6H9ClF3NO2 and a molecular weight of 219.59 g/mol. IUPAC name: 3-(chloromethyl)azetidine;2,2,2-trifluoroacetic acid. InChIKey: TVYVKBZHYQAILA-UHFFFAOYSA-N.
| Molecular formula | C6H9ClF3NO2 |
|---|---|
| Molecular weight | 219.59 g/mol |
| IUPAC name | 3-(chloromethyl)azetidine;2,2,2-trifluoroacetic acid |
| InChIKey | TVYVKBZHYQAILA-UHFFFAOYSA-N |
| SMILES | C1C(CN1)CCl.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)