Products 2242896-76-8

CAS 2242896-76-8 is the registry number for IL-1β-IN-2, 99.38%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 50 mg, 10mM/1mL, 25 mg, 5 mg.

Structural formula: {0} (CAS {1})

2-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methyl-5-pentylbenzene-1,3-diol (CAS 2242896-76-8) is a chemical compound with the molecular formula C22H34O2 and a molecular weight of 330.5 g/mol. IUPAC name: 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methyl-5-pentylbenzene-1,3-diol. InChIKey: NDCNAGIHMAFCOX-GHRIWEEISA-N.

Identity
Molecular formulaC22H34O2
Molecular weight330.5 g/mol
IUPAC name2-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methyl-5-pentylbenzene-1,3-diol
InChIKeyNDCNAGIHMAFCOX-GHRIWEEISA-N
SMILESCCCCCC1=CC(=C(C(=C1C)O)C/C=C(\C)/CCC=C(C)C)O

Computed by PubChem (NCBI)

Synonyms: orb1944467