CAS 22433-90-5 appears in our catalog under these names: 2-Bromobenzene-1,3-dicarbonitrile, 95%, 2–Bromoisophthalonitrile, 2-Bromo-1,3-benzenedicarbonitrile, 97%, 97%, 2-Bromoisophthalonitrile, 98%, 2-Bromoisophthalonitrile, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
2-bromobenzene-1,3-dicarbonitrile (CAS 22433-90-5) is a chemical compound with the molecular formula C8H3BrN2 and a molecular weight of 207.03 g/mol. IUPAC name: 2-bromobenzene-1,3-dicarbonitrile. InChIKey: PCTWWYKFRYQMOH-UHFFFAOYSA-N.
| Molecular formula | C8H3BrN2 |
|---|---|
| Molecular weight | 207.03 g/mol |
| IUPAC name | 2-bromobenzene-1,3-dicarbonitrile |
| InChIKey | PCTWWYKFRYQMOH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C#N)Br)C#N |
Computed by PubChem (NCBI)