CAS 76241-80-0 appears in our catalog under these names: 3-Bromophthalonitrile, 95+%, 3-Bromobenzene-1,2-dicarbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-bromobenzene-1,2-dicarbonitrile (CAS 76241-80-0) is a chemical compound with the molecular formula C8H3BrN2 and a molecular weight of 207.03 g/mol. IUPAC name: 3-bromobenzene-1,2-dicarbonitrile. InChIKey: VYNRAZJFOMVDKS-UHFFFAOYSA-N.
| Molecular formula | C8H3BrN2 |
|---|---|
| Molecular weight | 207.03 g/mol |
| IUPAC name | 3-bromobenzene-1,2-dicarbonitrile |
| InChIKey | VYNRAZJFOMVDKS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)C#N)C#N |
Computed by PubChem (NCBI)