Products 2243504-25-6

CAS 2243504-25-6 is the registry number for 3-(Cyclopropylmethyl)-4-hydroxy-5-methoxybenzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-(cyclopropylmethyl)-4-hydroxy-5-methoxybenzoic acid (CAS 2243504-25-6) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: 3-(cyclopropylmethyl)-4-hydroxy-5-methoxybenzoic acid. InChIKey: IWWKEOWXWQMCAR-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14O4
Molecular weight222.24 g/mol
IUPAC name3-(cyclopropylmethyl)-4-hydroxy-5-methoxybenzoic acid
InChIKeyIWWKEOWXWQMCAR-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1O)CC2CC2)C(=O)O

Computed by PubChem (NCBI)