CAS 2243507-94-8 is the registry number for 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-6-chloronicotinic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-2-(9H-fluoren-9-ylmethoxycarbonylamino)pyridine-3-carboxylic acid (CAS 2243507-94-8) is a chemical compound with the molecular formula C21H15ClN2O4 and a molecular weight of 394.8 g/mol. IUPAC name: 6-chloro-2-(9H-fluoren-9-ylmethoxycarbonylamino)pyridine-3-carboxylic acid. InChIKey: FWVLPOSNWJOPRS-UHFFFAOYSA-N.
| Molecular formula | C21H15ClN2O4 |
|---|---|
| Molecular weight | 394.8 g/mol |
| IUPAC name | 6-chloro-2-(9H-fluoren-9-ylmethoxycarbonylamino)pyridine-3-carboxylic acid |
| InChIKey | FWVLPOSNWJOPRS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=C(C=CC(=N4)Cl)C(=O)O |
Computed by PubChem (NCBI)