Products 307338-57-4

CAS 307338-57-4 is the registry number for 2-((3-((3-Chlorophenyl)carbamoyl)phenyl)carbamoyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[[3-[(3-chlorophenyl)carbamoyl]phenyl]carbamoyl]benzoic acid (CAS 307338-57-4) is a chemical compound with the molecular formula C21H15ClN2O4 and a molecular weight of 394.8 g/mol. IUPAC name: 2-[[3-[(3-chlorophenyl)carbamoyl]phenyl]carbamoyl]benzoic acid. InChIKey: UKTMKQVBXSKYBT-UHFFFAOYSA-N.

Identity
Molecular formulaC21H15ClN2O4
Molecular weight394.8 g/mol
IUPAC name2-[[3-[(3-chlorophenyl)carbamoyl]phenyl]carbamoyl]benzoic acid
InChIKeyUKTMKQVBXSKYBT-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)NC2=CC=CC(=C2)C(=O)NC3=CC(=CC=C3)Cl)C(=O)O

Computed by PubChem (NCBI)