Products 2243507-97-1

CAS 2243507-97-1 is the registry number for 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3,6-difluorobenzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,6-difluorobenzoic acid (CAS 2243507-97-1) is a chemical compound with the molecular formula C22H15F2NO4 and a molecular weight of 395.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,6-difluorobenzoic acid. InChIKey: YPVJGIGSNUHGMG-UHFFFAOYSA-N.

Identity
Molecular formulaC22H15F2NO4
Molecular weight395.4 g/mol
IUPAC name2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,6-difluorobenzoic acid
InChIKeyYPVJGIGSNUHGMG-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=C(C=CC(=C4C(=O)O)F)F

Computed by PubChem (NCBI)