CAS 2243515-97-9 is the registry number for 4-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2,5-difluorobenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(9H-fluoren-9-ylmethoxycarbonylamino)-2,5-difluorobenzoic acid (CAS 2243515-97-9) is a chemical compound with the molecular formula C22H15F2NO4 and a molecular weight of 395.4 g/mol. IUPAC name: 4-(9H-fluoren-9-ylmethoxycarbonylamino)-2,5-difluorobenzoic acid. InChIKey: IIQJNGHSOYVRSI-UHFFFAOYSA-N.
| Molecular formula | C22H15F2NO4 |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | 4-(9H-fluoren-9-ylmethoxycarbonylamino)-2,5-difluorobenzoic acid |
| InChIKey | IIQJNGHSOYVRSI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=C(C=C(C(=C4)F)C(=O)O)F |
Computed by PubChem (NCBI)