Products 2243511-83-1
CAS 2243511-83-1 is the registry number for 1-((tert-Butoxy)carbonyl)-3-carbamoylazetidine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-carbamoyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid (CAS 2243511-83-1) is a chemical compound with the molecular formula C10H16N2O5 and a molecular weight of 244.24 g/mol. IUPAC name: 3-carbamoyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid. InChIKey: POEHRFUFSXZPHC-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O5 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | 3-carbamoyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid |
| InChIKey | POEHRFUFSXZPHC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(C(=O)N)C(=O)O |
Computed by PubChem (NCBI)