CAS 2243520-64-9 is the registry number for 4-(Piperidin-3-yl)phenol hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-piperidin-3-ylphenol;hydrochloride (CAS 2243520-64-9) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: 4-piperidin-3-ylphenol;hydrochloride. InChIKey: WZRJBQSXAKPAKW-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | 4-piperidin-3-ylphenol;hydrochloride |
| InChIKey | WZRJBQSXAKPAKW-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C2=CC=C(C=C2)O.Cl |
Computed by PubChem (NCBI)