Products 2243587-06-4

CAS 2243587-06-4 is the registry number for 3,5-Dinitro-2-hydroxyphenylacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 10g, 5g.

Structural formula: {0} (CAS {1})

2-(2-hydroxy-3,5-dinitrophenyl)acetic acid (CAS 2243587-06-4) is a chemical compound with the molecular formula C8H6N2O7 and a molecular weight of 242.14 g/mol. IUPAC name: 2-(2-hydroxy-3,5-dinitrophenyl)acetic acid. InChIKey: BLVSIPNFAPTXMN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6N2O7
Molecular weight242.14 g/mol
IUPAC name2-(2-hydroxy-3,5-dinitrophenyl)acetic acid
InChIKeyBLVSIPNFAPTXMN-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1CC(=O)O)O)[N+](=O)[O-])[N+](=O)[O-]

Computed by PubChem (NCBI)