CAS 33927-05-8 is the registry number for Methyl 3,5-dinitro-4-hydroxybenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
Methyl 4-hydroxy-3,5-dinitrobenzoate (CAS 33927-05-8) is a chemical compound with the molecular formula C8H6N2O7 and a molecular weight of 242.14 g/mol. IUPAC name: methyl 4-hydroxy-3,5-dinitrobenzoate. InChIKey: CNPJNFNJIODHOF-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O7 |
|---|---|
| Molecular weight | 242.14 g/mol |
| IUPAC name | methyl 4-hydroxy-3,5-dinitrobenzoate |
| InChIKey | CNPJNFNJIODHOF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)[N+](=O)[O-])O)[N+](=O)[O-] |
Computed by PubChem (NCBI)