Products 2244064-25-1
CAS 2244064-25-1 is the registry number for (S)-Ethyl 3-(piperidin-2-yl)benzoate hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ethyl 3-[(2S)-piperidin-2-yl]benzoate;hydrochloride (CAS 2244064-25-1) is a chemical compound with the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. IUPAC name: ethyl 3-[(2S)-piperidin-2-yl]benzoate;hydrochloride. InChIKey: LGNULXJOMKDLPQ-ZOWNYOTGSA-N.
| Molecular formula | C14H20ClNO2 |
|---|---|
| Molecular weight | 269.77 g/mol |
| IUPAC name | ethyl 3-[(2S)-piperidin-2-yl]benzoate;hydrochloride |
| InChIKey | LGNULXJOMKDLPQ-ZOWNYOTGSA-N |
| SMILES | CCOC(=O)C1=CC=CC(=C1)[C@@H]2CCCCN2.Cl |
Computed by PubChem (NCBI)