Products 22442-47-3
CAS 22442-47-3 appears in our catalog under these names: 3-(4-Methoxy-3-methylphenyl)propanoic acid, 3-(4-Methoxy-3-methylphenyl)propanoic acid, 95%, 3-(4-Methoxy-3-methylphenyl)propanoic acid, 98%, 3-(4-Methoxy-3-methyl-phenyl)-propionic acid, 98%, 98%. Offered by: Biosynth, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 2,5g, 250mg, 1g, 100mg, 5g.
3-(4-methoxy-3-methylphenyl)propanoic acid (CAS 22442-47-3) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: 3-(4-methoxy-3-methylphenyl)propanoic acid. InChIKey: ZATPJYSLVGVGGY-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 3-(4-methoxy-3-methylphenyl)propanoic acid |
| InChIKey | ZATPJYSLVGVGGY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)CCC(=O)O)OC |
Computed by PubChem (NCBI)