CAS 2244235-26-3 appears in our catalog under these names: moc-α-Me-Trp-OH 95%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(1H-indol-3-yl)-2-methylpropanoic acid, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 5g, 50mg, 100mg, 250mg, 1g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-indol-3-yl)-2-methylpropanoic acid (CAS 2244235-26-3) is a chemical compound with the molecular formula C27H24N2O4 and a molecular weight of 440.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-indol-3-yl)-2-methylpropanoic acid. InChIKey: KPEBLOCUSAZTGS-MHZLTWQESA-N.
| Molecular formula | C27H24N2O4 |
|---|---|
| Molecular weight | 440.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1H-indol-3-yl)-2-methylpropanoic acid |
| InChIKey | KPEBLOCUSAZTGS-MHZLTWQESA-N |
| SMILES | C[C@](CC1=CNC2=CC=CC=C21)(C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)