CAS 2244399-86-6 is the registry number for 3-(1-Naphthalenyl)[1,1′-biphenyl]-4-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-naphthalen-1-yl-4-phenylaniline (CAS 2244399-86-6) is a chemical compound with the molecular formula C22H17N and a molecular weight of 295.4 g/mol. IUPAC name: 2-naphthalen-1-yl-4-phenylaniline. InChIKey: XPENCKNHRUSIFH-UHFFFAOYSA-N.
| Molecular formula | C22H17N |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | 2-naphthalen-1-yl-4-phenylaniline |
| InChIKey | XPENCKNHRUSIFH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)N)C3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)