CAS 2734839-92-8 is the registry number for 2-(2-naphthalenyl)-[1,1′-Biphenyl]-4-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-naphthalen-2-yl-4-phenylaniline (CAS 2734839-92-8) is a chemical compound with the molecular formula C22H17N and a molecular weight of 295.4 g/mol. IUPAC name: 3-naphthalen-2-yl-4-phenylaniline. InChIKey: XDZZVNOLQJWTGV-UHFFFAOYSA-N.
| Molecular formula | C22H17N |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | 3-naphthalen-2-yl-4-phenylaniline |
| InChIKey | XDZZVNOLQJWTGV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=C(C=C2)N)C3=CC4=CC=CC=C4C=C3 |
Computed by PubChem (NCBI)