CAS 2244529-63-1 is the registry number for Milrinone Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.
(Z)-4-ethoxy-3-pyridin-4-ylbut-3-en-2-one (CAS 2244529-63-1) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: (Z)-4-ethoxy-3-pyridin-4-ylbut-3-en-2-one. InChIKey: IATKKGJZTHMRBF-DHZHZOJOSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | (Z)-4-ethoxy-3-pyridin-4-ylbut-3-en-2-one |
| InChIKey | IATKKGJZTHMRBF-DHZHZOJOSA-N |
| SMILES | CCO/C=C(/C1=CC=NC=C1)\C(=O)C |
Computed by PubChem (NCBI)