CAS 2244532-65-6 appears in our catalog under these names: Fmoc-Trp(4-F)-OH 97%, N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-4-fluoro-L-tryptophan, 98%, 98%, Fmoc-Trp(4-F)-OH, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-fluoro-1H-indol-3-yl)propanoic acid (CAS 2244532-65-6) is a chemical compound with the molecular formula C26H21FN2O4 and a molecular weight of 444.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-fluoro-1H-indol-3-yl)propanoic acid. InChIKey: GIPFRXZWFYXWKG-QHCPKHFHSA-N.
| Molecular formula | C26H21FN2O4 |
|---|---|
| Molecular weight | 444.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-fluoro-1H-indol-3-yl)propanoic acid |
| InChIKey | GIPFRXZWFYXWKG-QHCPKHFHSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CNC5=C4C(=CC=C5)F)C(=O)O |
Computed by PubChem (NCBI)