CAS 2349820-34-2 is the registry number for N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-4-fluoro-D-tryptophan, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-fluoro-1H-indol-3-yl)propanoic acid (CAS 2349820-34-2) is a chemical compound with the molecular formula C26H21FN2O4 and a molecular weight of 444.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-fluoro-1H-indol-3-yl)propanoic acid. InChIKey: GIPFRXZWFYXWKG-HSZRJFAPSA-N.
| Molecular formula | C26H21FN2O4 |
|---|---|
| Molecular weight | 444.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-fluoro-1H-indol-3-yl)propanoic acid |
| InChIKey | GIPFRXZWFYXWKG-HSZRJFAPSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CNC5=C4C(=CC=C5)F)C(=O)O |
Computed by PubChem (NCBI)