Products 2244560-40-3
CAS 2244560-40-3 is the registry number for (R)-2-Isopropyl-8,8,8a-trimethyl-6,7,8,8a-tetrahydrophenanthrene-3,4-diol. Offered by: MedChemExpress. Available pack sizes: Get quote.
(8aR)-8,8,8a-trimethyl-2-propan-2-yl-6,7-dihydrophenanthrene-3,4-diol (CAS 2244560-40-3) is a chemical compound with the molecular formula C20H26O2 and a molecular weight of 298.4 g/mol. IUPAC name: (8aR)-8,8,8a-trimethyl-2-propan-2-yl-6,7-dihydrophenanthrene-3,4-diol. InChIKey: RGZFDXJHQPJDER-FQEVSTJZSA-N.
| Molecular formula | C20H26O2 |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | (8aR)-8,8,8a-trimethyl-2-propan-2-yl-6,7-dihydrophenanthrene-3,4-diol |
| InChIKey | RGZFDXJHQPJDER-FQEVSTJZSA-N |
| SMILES | CC(C)C1=C(C(=C2C3=CCCC([C@]3(C=CC2=C1)C)(C)C)O)O |
Computed by PubChem (NCBI)