CAS 224627-26-3 appears in our catalog under these names: 1-Boc-4-oxo-d-proline benzyl ester, 95%, 1–Boc–4–oxo–D–proline benzyl ester, 1-Boc-4-oxo-D-proline benzyl ester, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 500mg.
2-O-benzyl 1-O-tert-butyl (2R)-4-oxopyrrolidine-1,2-dicarboxylate (CAS 224627-26-3) is a chemical compound with the molecular formula C17H21NO5 and a molecular weight of 319.4 g/mol. IUPAC name: 2-O-benzyl 1-O-tert-butyl (2R)-4-oxopyrrolidine-1,2-dicarboxylate. InChIKey: JBOGNSRGCLEJEM-CQSZACIVSA-N.
| Molecular formula | C17H21NO5 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 2-O-benzyl 1-O-tert-butyl (2R)-4-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | JBOGNSRGCLEJEM-CQSZACIVSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)C[C@@H]1C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)