Products 2385122-61-0

CAS 2385122-61-0 is the registry number for 4-Benzyloxy-3,3-dimethyl-butyric acid 2,5-dioxo-pyrrolidin-1-yl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

(2,5-dioxopyrrolidin-1-yl) 3,3-dimethyl-4-phenylmethoxybutanoate (CAS 2385122-61-0) is a chemical compound with the molecular formula C17H21NO5 and a molecular weight of 319.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3,3-dimethyl-4-phenylmethoxybutanoate. InChIKey: KBQFAOULCJNRBX-UHFFFAOYSA-N.

Identity
Molecular formulaC17H21NO5
Molecular weight319.4 g/mol
IUPAC name(2,5-dioxopyrrolidin-1-yl) 3,3-dimethyl-4-phenylmethoxybutanoate
InChIKeyKBQFAOULCJNRBX-UHFFFAOYSA-N
SMILESCC(C)(CC(=O)ON1C(=O)CCC1=O)COCC2=CC=CC=C2

Computed by PubChem (NCBI)