Products 2246722-82-5
CAS 2246722-82-5 is the registry number for [3-bromo-1-(oxan-2-yl)-1H-pyrazol-5-yl]methanol, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
[3-bromo-1-(oxan-2-yl)pyrazol-5-yl]methanol (CAS 2246722-82-5) is a chemical compound with the molecular formula C9H13BrN2O2 and a molecular weight of 261.12 g/mol. IUPAC name: [3-bromo-1-(oxan-2-yl)pyrazol-5-yl]methanol. InChIKey: PQEXFVZMDLCINW-UHFFFAOYSA-N.
| Molecular formula | C9H13BrN2O2 |
|---|---|
| Molecular weight | 261.12 g/mol |
| IUPAC name | [3-bromo-1-(oxan-2-yl)pyrazol-5-yl]methanol |
| InChIKey | PQEXFVZMDLCINW-UHFFFAOYSA-N |
| SMILES | C1CCOC(C1)N2C(=CC(=N2)Br)CO |
Computed by PubChem (NCBI)