Products 2246857-94-1
CAS 2246857-94-1 is the registry number for 2-(4-(Tert-butoxymethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg.
4,4,5,5-tetramethyl-2-[4-[(2-methylpropan-2-yl)oxymethyl]phenyl]-1,3,2-dioxaborolane (CAS 2246857-94-1) is a chemical compound with the molecular formula C17H27BO3 and a molecular weight of 290.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[4-[(2-methylpropan-2-yl)oxymethyl]phenyl]-1,3,2-dioxaborolane. InChIKey: KOTAYNVYCCGRHQ-UHFFFAOYSA-N.
| Molecular formula | C17H27BO3 |
|---|---|
| Molecular weight | 290.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[4-[(2-methylpropan-2-yl)oxymethyl]phenyl]-1,3,2-dioxaborolane |
| InChIKey | KOTAYNVYCCGRHQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)COC(C)(C)C |
Computed by PubChem (NCBI)