Products 2246560-92-7
CAS 2246560-92-7 is the registry number for 4,4,5,5-Tetramethyl-2-(3-(neopentyloxy)phenyl)-1,3,2-dioxaborolane, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g.
2-[3-(2,2-dimethylpropoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2246560-92-7) is a chemical compound with the molecular formula C17H27BO3 and a molecular weight of 290.2 g/mol. IUPAC name: 2-[3-(2,2-dimethylpropoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: LPQQUXMZBKOHRB-UHFFFAOYSA-N.
| Molecular formula | C17H27BO3 |
|---|---|
| Molecular weight | 290.2 g/mol |
| IUPAC name | 2-[3-(2,2-dimethylpropoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | LPQQUXMZBKOHRB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)OCC(C)(C)C |
Computed by PubChem (NCBI)