CAS 1218789-82-2 is the registry number for 3-Butoxy-5-methylphenylboronic acid, pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(3-butoxy-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1218789-82-2) is a chemical compound with the molecular formula C17H27BO3 and a molecular weight of 290.2 g/mol. IUPAC name: 2-(3-butoxy-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: IYHABOWXIZNELA-UHFFFAOYSA-N.
| Molecular formula | C17H27BO3 |
|---|---|
| Molecular weight | 290.2 g/mol |
| IUPAC name | 2-(3-butoxy-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | IYHABOWXIZNELA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)OCCCC)C |
Computed by PubChem (NCBI)