Products 1218789-82-2

CAS 1218789-82-2 is the registry number for 3-Butoxy-5-methylphenylboronic acid, pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(3-butoxy-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1218789-82-2) is a chemical compound with the molecular formula C17H27BO3 and a molecular weight of 290.2 g/mol. IUPAC name: 2-(3-butoxy-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: IYHABOWXIZNELA-UHFFFAOYSA-N.

Identity
Molecular formulaC17H27BO3
Molecular weight290.2 g/mol
IUPAC name2-(3-butoxy-5-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
InChIKeyIYHABOWXIZNELA-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)OCCCC)C

Computed by PubChem (NCBI)