CAS 2246858-23-9 appears in our catalog under these names: 4-(S-Propylthiomethyl)phenylboronic acid, pinacol ester, 98%, 4,4,5,5-Tetramethyl-2-(4-((propylthio)methyl)phenyl)-1,3,2-dioxaborolane 98%, 4-(S-Propylthiomethyl)phenylboronic acid, pinacol ester, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg.
4,4,5,5-tetramethyl-2-[4-(propylsulfanylmethyl)phenyl]-1,3,2-dioxaborolane (CAS 2246858-23-9) is a chemical compound with the molecular formula C16H25BO2S and a molecular weight of 292.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[4-(propylsulfanylmethyl)phenyl]-1,3,2-dioxaborolane. InChIKey: RWXOJPUWDLXNJQ-UHFFFAOYSA-N.
| Molecular formula | C16H25BO2S |
|---|---|
| Molecular weight | 292.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[4-(propylsulfanylmethyl)phenyl]-1,3,2-dioxaborolane |
| InChIKey | RWXOJPUWDLXNJQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CSCCC |
Computed by PubChem (NCBI)