CAS 909255-87-4 is the registry number for 2-[4-(tert-butylsulfanyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-(4-tert-butylsulfanylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 909255-87-4) is a chemical compound with the molecular formula C16H25BO2S and a molecular weight of 292.2 g/mol. IUPAC name: 2-(4-tert-butylsulfanylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: LOAPXNKARMOWAX-UHFFFAOYSA-N.
| Molecular formula | C16H25BO2S |
|---|---|
| Molecular weight | 292.2 g/mol |
| IUPAC name | 2-(4-tert-butylsulfanylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | LOAPXNKARMOWAX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)SC(C)(C)C |
Computed by PubChem (NCBI)