CAS 2246865-32-5 appears in our catalog under these names: (3-(3-Bromobenzamido)phenyl)boronic acid, 97%, (3-(3-Bromobenzamido)phenyl)boronic acid, 98%, (3–(3–bromobenzamido)phenyl)boronic acid, (3-(3-bromobenzamido)phenyl)boronic acid, 95%, 95%, (3-(3-BROMOBENZAMIDO)PHENYL)BORONIC ACID, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
[3-[(3-bromobenzoyl)amino]phenyl]boronic acid (CAS 2246865-32-5) is a chemical compound with the molecular formula C13H11BBrNO3 and a molecular weight of 319.95 g/mol. IUPAC name: [3-[(3-bromobenzoyl)amino]phenyl]boronic acid. InChIKey: KBCGMBZQPOUYLW-UHFFFAOYSA-N.
| Molecular formula | C13H11BBrNO3 |
|---|---|
| Molecular weight | 319.95 g/mol |
| IUPAC name | [3-[(3-bromobenzoyl)amino]phenyl]boronic acid |
| InChIKey | KBCGMBZQPOUYLW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)NC(=O)C2=CC(=CC=C2)Br)(O)O |
Computed by PubChem (NCBI)