Products 2246876-17-3
CAS 2246876-17-3 is the registry number for 3-(Propan-2-yl)-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole (CAS 2246876-17-3) is a chemical compound with the molecular formula C12H20BNO3 and a molecular weight of 237.11 g/mol. IUPAC name: 3-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole. InChIKey: XRFMWTVSRPDMLW-UHFFFAOYSA-N.
| Molecular formula | C12H20BNO3 |
|---|---|
| Molecular weight | 237.11 g/mol |
| IUPAC name | 3-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2-oxazole |
| InChIKey | XRFMWTVSRPDMLW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NO2)C(C)C |
Computed by PubChem (NCBI)