CAS 2710297-55-3 is the registry number for 2-Isopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazole (CAS 2710297-55-3) is a chemical compound with the molecular formula C12H20BNO3 and a molecular weight of 237.11 g/mol. IUPAC name: 2-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazole. InChIKey: VYPXHCGUWDFFGE-UHFFFAOYSA-N.
| Molecular formula | C12H20BNO3 |
|---|---|
| Molecular weight | 237.11 g/mol |
| IUPAC name | 2-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-oxazole |
| InChIKey | VYPXHCGUWDFFGE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=COC(=N2)C(C)C |
Computed by PubChem (NCBI)