CAS 2247038-89-5 appears in our catalog under these names: 2,6-Dibromo-4-chlorobenzaldehyde 95%, 2,6-Dibromo-4-chlorobenzaldehyde, 95%, 95%, 2,6-Dibromo-4-chloro-benzaldehyde, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 500mg.
2,6-dibromo-4-chlorobenzaldehyde (CAS 2247038-89-5) is a chemical compound with the molecular formula C7H3Br2ClO and a molecular weight of 298.36 g/mol. IUPAC name: 2,6-dibromo-4-chlorobenzaldehyde. InChIKey: UGLGRHBWAQLGIC-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2ClO |
|---|---|
| Molecular weight | 298.36 g/mol |
| IUPAC name | 2,6-dibromo-4-chlorobenzaldehyde |
| InChIKey | UGLGRHBWAQLGIC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)C=O)Br)Cl |
Computed by PubChem (NCBI)