CAS 861303-23-3 is the registry number for 3,5-dibromo-4-chlorobenzaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3,5-dibromo-4-chlorobenzaldehyde (CAS 861303-23-3) is a chemical compound with the molecular formula C7H3Br2ClO and a molecular weight of 298.36 g/mol. IUPAC name: 3,5-dibromo-4-chlorobenzaldehyde. InChIKey: FJFSDCZFTNDOII-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2ClO |
|---|---|
| Molecular weight | 298.36 g/mol |
| IUPAC name | 3,5-dibromo-4-chlorobenzaldehyde |
| InChIKey | FJFSDCZFTNDOII-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)Cl)Br)C=O |
Computed by PubChem (NCBI)