CAS 2247088-01-1 is the registry number for ((2S)-4-Cyclopropylmorpholin-2-yl)methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[(2S)-4-cyclopropylmorpholin-2-yl]methanamine;dihydrochloride (CAS 2247088-01-1) is a chemical compound with the molecular formula C8H18Cl2N2O and a molecular weight of 229.14 g/mol. IUPAC name: [(2S)-4-cyclopropylmorpholin-2-yl]methanamine;dihydrochloride. InChIKey: GELKCKCVADQERZ-JZGIKJSDSA-N.
| Molecular formula | C8H18Cl2N2O |
|---|---|
| Molecular weight | 229.14 g/mol |
| IUPAC name | [(2S)-4-cyclopropylmorpholin-2-yl]methanamine;dihydrochloride |
| InChIKey | GELKCKCVADQERZ-JZGIKJSDSA-N |
| SMILES | C1CC1N2CCO[C@H](C2)CN.Cl.Cl |
Computed by PubChem (NCBI)