CAS 2247094-36-4 is the registry number for 6-Bromo-1-(2,2-difluoroethyl)-1H-benzo[d][1,2,3]triazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-1-(2,2-difluoroethyl)benzotriazole (CAS 2247094-36-4) is a chemical compound with the molecular formula C8H6BrF2N3 and a molecular weight of 262.05 g/mol. IUPAC name: 6-bromo-1-(2,2-difluoroethyl)benzotriazole. InChIKey: CFJYXFQPQCEBLN-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF2N3 |
|---|---|
| Molecular weight | 262.05 g/mol |
| IUPAC name | 6-bromo-1-(2,2-difluoroethyl)benzotriazole |
| InChIKey | CFJYXFQPQCEBLN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)N(N=N2)CC(F)F |
Computed by PubChem (NCBI)