CAS 2748796-42-9 is the registry number for 6-Bromo-4,7-difluoro-1-methyl-1H-indazol-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-4,7-difluoro-1-methylindazol-3-amine (CAS 2748796-42-9) is a chemical compound with the molecular formula C8H6BrF2N3 and a molecular weight of 262.05 g/mol. IUPAC name: 6-bromo-4,7-difluoro-1-methylindazol-3-amine. InChIKey: HHLOMXMYKIRNGK-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF2N3 |
|---|---|
| Molecular weight | 262.05 g/mol |
| IUPAC name | 6-bromo-4,7-difluoro-1-methylindazol-3-amine |
| InChIKey | HHLOMXMYKIRNGK-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=CC(=C2F)Br)F)C(=N1)N |
Computed by PubChem (NCBI)