CAS 2247105-94-6 is the registry number for 4-(3,4-Difluorophenyl)-1H-pyrazole hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(3,4-difluorophenyl)-1H-pyrazole;hydrochloride (CAS 2247105-94-6) is a chemical compound with the molecular formula C9H7ClF2N2 and a molecular weight of 216.61 g/mol. IUPAC name: 4-(3,4-difluorophenyl)-1H-pyrazole;hydrochloride. InChIKey: ODVHKTYXUQHXRM-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2N2 |
|---|---|
| Molecular weight | 216.61 g/mol |
| IUPAC name | 4-(3,4-difluorophenyl)-1H-pyrazole;hydrochloride |
| InChIKey | ODVHKTYXUQHXRM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CNN=C2)F)F.Cl |
Computed by PubChem (NCBI)