CAS 2747919-24-8 is the registry number for 8-Chloro-6-(1,1-difluoroethyl)imidazo[1,2-a]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-chloro-6-(1,1-difluoroethyl)imidazo[1,2-a]pyridine (CAS 2747919-24-8) is a chemical compound with the molecular formula C9H7ClF2N2 and a molecular weight of 216.61 g/mol. IUPAC name: 8-chloro-6-(1,1-difluoroethyl)imidazo[1,2-a]pyridine. InChIKey: WFXHHIYVYWVRPE-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF2N2 |
|---|---|
| Molecular weight | 216.61 g/mol |
| IUPAC name | 8-chloro-6-(1,1-difluoroethyl)imidazo[1,2-a]pyridine |
| InChIKey | WFXHHIYVYWVRPE-UHFFFAOYSA-N |
| SMILES | CC(C1=CN2C=CN=C2C(=C1)Cl)(F)F |
Computed by PubChem (NCBI)