Products 2247106-08-5
CAS 2247106-08-5 is the registry number for 4,4-Dimethyl-1-oxa-3,8-diazaspiro(4.5)decan-2-one hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4,4-dimethyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one;hydrochloride (CAS 2247106-08-5) is a chemical compound with the molecular formula C9H17ClN2O2 and a molecular weight of 220.69 g/mol. IUPAC name: 4,4-dimethyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one;hydrochloride. InChIKey: DCENDMNJIRKAJO-UHFFFAOYSA-N.
| Molecular formula | C9H17ClN2O2 |
|---|---|
| Molecular weight | 220.69 g/mol |
| IUPAC name | 4,4-dimethyl-1-oxa-3,8-diazaspiro[4.5]decan-2-one;hydrochloride |
| InChIKey | DCENDMNJIRKAJO-UHFFFAOYSA-N |
| SMILES | CC1(C2(CCNCC2)OC(=O)N1)C.Cl |
Computed by PubChem (NCBI)