CAS 2247123-45-9 is the registry number for 2-Bromo-1-dibenzofuranol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-bromodibenzofuran-1-ol (CAS 2247123-45-9) is a chemical compound with the molecular formula C12H7BrO2 and a molecular weight of 263.09 g/mol. IUPAC name: 2-bromodibenzofuran-1-ol. InChIKey: OPOVGTURCHZJBW-UHFFFAOYSA-N.
| Molecular formula | C12H7BrO2 |
|---|---|
| Molecular weight | 263.09 g/mol |
| IUPAC name | 2-bromodibenzofuran-1-ol |
| InChIKey | OPOVGTURCHZJBW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=CC(=C3O)Br |
Computed by PubChem (NCBI)