CAS 873974-43-7 is the registry number for 1-Bromo-dibenzofuran-4-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-bromodibenzofuran-4-ol (CAS 873974-43-7) is a chemical compound with the molecular formula C12H7BrO2 and a molecular weight of 263.09 g/mol. IUPAC name: 1-bromodibenzofuran-4-ol. InChIKey: RNNOJDJYFVRUCZ-UHFFFAOYSA-N.
| Molecular formula | C12H7BrO2 |
|---|---|
| Molecular weight | 263.09 g/mol |
| IUPAC name | 1-bromodibenzofuran-4-ol |
| InChIKey | RNNOJDJYFVRUCZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C=CC(=C3O2)O)Br |
Computed by PubChem (NCBI)