CAS 2248266-55-7 is the registry number for 2-Amino-3-(5-hydroxypyridin-3-yl)propanoic acid dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-amino-3-(5-hydroxy-3-pyridinyl)propanoic acid;dihydrochloride (CAS 2248266-55-7) is a chemical compound with the molecular formula C8H12Cl2N2O3 and a molecular weight of 255.10 g/mol. IUPAC name: 2-amino-3-(5-hydroxy-3-pyridinyl)propanoic acid;dihydrochloride. InChIKey: FYFBWHYGGUEODO-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N2O3 |
|---|---|
| Molecular weight | 255.10 g/mol |
| IUPAC name | 2-amino-3-(5-hydroxy-3-pyridinyl)propanoic acid;dihydrochloride |
| InChIKey | FYFBWHYGGUEODO-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1O)CC(C(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)