Products 2287260-11-9

CAS 2287260-11-9 is the registry number for 2-Amino-3-(2-hydroxypyridin-3-yl)propanoic acid dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-amino-3-(2-oxo-1H-pyridin-3-yl)propanoic acid;dihydrochloride (CAS 2287260-11-9) is a chemical compound with the molecular formula C8H12Cl2N2O3 and a molecular weight of 255.10 g/mol. IUPAC name: 2-amino-3-(2-oxo-1H-pyridin-3-yl)propanoic acid;dihydrochloride. InChIKey: XQKUIUKXPXVDLY-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12Cl2N2O3
Molecular weight255.10 g/mol
IUPAC name2-amino-3-(2-oxo-1H-pyridin-3-yl)propanoic acid;dihydrochloride
InChIKeyXQKUIUKXPXVDLY-UHFFFAOYSA-N
SMILESC1=CNC(=O)C(=C1)CC(C(=O)O)N.Cl.Cl

Computed by PubChem (NCBI)