Products 22483-40-5
CAS 22483-40-5 appears in our catalog under these names: 1–(2–Methoxyethoxy)–4–nitrobenzene, 1-(2-Methoxyethoxy)-4-nitrobenzene 98%, 1-(2-Methoxyethoxy)-4-nitrobenzene, 98%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 25g, 10g.
1-(2-methoxyethoxy)-4-nitrobenzene (CAS 22483-40-5) is a chemical compound with the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. IUPAC name: 1-(2-methoxyethoxy)-4-nitrobenzene. InChIKey: AMSIAIRQIAPAPM-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 1-(2-methoxyethoxy)-4-nitrobenzene |
| InChIKey | AMSIAIRQIAPAPM-UHFFFAOYSA-N |
| SMILES | COCCOC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)