Products 2248317-99-7
CAS 2248317-99-7 is the registry number for 2,2-Dimethyl-1-oxa-4,8-diazaspiro(4.5)decan-3-one hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,2-dimethyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one;hydrochloride (CAS 2248317-99-7) is a chemical compound with the molecular formula C9H17ClN2O2 and a molecular weight of 220.69 g/mol. IUPAC name: 2,2-dimethyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one;hydrochloride. InChIKey: IEQJRNNRXLIBHL-UHFFFAOYSA-N.
| Molecular formula | C9H17ClN2O2 |
|---|---|
| Molecular weight | 220.69 g/mol |
| IUPAC name | 2,2-dimethyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one;hydrochloride |
| InChIKey | IEQJRNNRXLIBHL-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC2(O1)CCNCC2)C.Cl |
Computed by PubChem (NCBI)