Products 2248328-10-9
CAS 2248328-10-9 is the registry number for rac-((1R,3S)-3-Ethynylcyclohexyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[(1R,3S)-3-ethynylcyclohexyl]methanamine;hydrochloride (CAS 2248328-10-9) is a chemical compound with the molecular formula C9H16ClN and a molecular weight of 173.68 g/mol. IUPAC name: [(1R,3S)-3-ethynylcyclohexyl]methanamine;hydrochloride. InChIKey: PGXQEBLWNUJWAJ-OULXEKPRSA-N.
| Molecular formula | C9H16ClN |
|---|---|
| Molecular weight | 173.68 g/mol |
| IUPAC name | [(1R,3S)-3-ethynylcyclohexyl]methanamine;hydrochloride |
| InChIKey | PGXQEBLWNUJWAJ-OULXEKPRSA-N |
| SMILES | C#C[C@H]1CCC[C@H](C1)CN.Cl |
Computed by PubChem (NCBI)